C16H33N3O3 — CID 18941878
tert-butyl N-[5-(6-aminohexanoylamino)pentyl]carbamate (PubChem CID 18941878) has the molecular formula C16H33N3O3 and a molecular weight of 315.46 g/mol. Its IUPAC name is tert-butyl N-[5-(6-aminohexanoylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[5-(6-aminohexanoylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 18941878 |
| Molecular Formula | C16H33N3O3 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.25 |
| IUPAC Name | tert-butyl N-[5-(6-aminohexanoylamino)pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC(=O)CCCCCN |
| InChI | InChI=1S/C16H33N3O3/c1-16(2,3)22-15(21)19-13-9-5-8-12-18-14(20)10-6-4-7-11-17/h4-13,17H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | TVJYRJQBJQJQQZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|