C25H50N4O4 — CID 10576339
tert-butyl N-[6-[8-(6-aminohexanoylamino)octylamino]-6-oxohexyl]carbamate (PubChem CID 10576339) has the molecular formula C25H50N4O4 and a molecular weight of 470.70 g/mol. Its IUPAC name is tert-butyl N-[6-[8-(6-aminohexanoylamino)octylamino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[8-(6-aminohexanoylamino)octylamino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 10576339 |
| Molecular Formula | C25H50N4O4 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | tert-butyl N-[6-[8-(6-aminohexanoylamino)octylamino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)NCCCCCCCCNC(=O)CCCCCN |
| InChI | InChI=1S/C25H50N4O4/c1-25(2,3)33-24(32)29-21-15-9-11-17-23(31)28-20-14-7-5-4-6-13-19-27-22(30)16-10-8-12-18-26/h4-21,26H2,1-3H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | SDCBWWGDSMABBL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|