C13H27BrN2O4 — CID 87525773
2-bromoacetic acid;tert-butyl N-(6-aminohexyl)carbamate (PubChem CID 87525773) has the molecular formula C13H27BrN2O4 and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-bromoacetic acid;tert-butyl N-(6-aminohexyl)carbamate.
| Compound Name | 2-bromoacetic acid;tert-butyl N-(6-aminohexyl)carbamate |
|---|---|
| PubChem CID | 87525773 |
| Molecular Formula | C13H27BrN2O4 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-bromoacetic acid;tert-butyl N-(6-aminohexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCN.O=C(O)CBr |
| InChI | InChI=1S/C11H24N2O2.C2H3BrO2/c1-11(2,3)15-10(14)13-9-7-5-4-6-8-12;3-1-2(4)5/h4-9,12H2,1-3H3,(H,13,14);1H2,(H,4,5) |
| InChIKey | NMPINIRAFGNKRW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|