C24H50N4O4 — CID 57208248
tert-butyl N-[9-amino-4-(5-aminopentyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]nonyl]carbamate (PubChem CID 57208248) has the molecular formula C24H50N4O4 and a molecular weight of 458.69 g/mol. Its IUPAC name is tert-butyl N-[9-amino-4-(5-aminopentyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]nonyl]carbamate.
| Compound Name | tert-butyl N-[9-amino-4-(5-aminopentyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]nonyl]carbamate |
|---|---|
| PubChem CID | 57208248 |
| Molecular Formula | C24H50N4O4 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | tert-butyl N-[9-amino-4-(5-aminopentyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]nonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(CCCCCN)(CCCCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H50N4O4/c1-22(2,3)31-20(29)27-19-13-16-24(14-9-7-11-17-25,15-10-8-12-18-26)28-21(30)32-23(4,5)6/h7-19,25-26H2,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | DYKMFXCDDDFNNH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|