C19H40N2O2 — CID 169146336
tert-butyl N-(10-amino-5,5,8,8-tetramethyldecyl)carbamate (PubChem CID 169146336) has the molecular formula C19H40N2O2 and a molecular weight of 328.54 g/mol. Its IUPAC name is tert-butyl N-(10-amino-5,5,8,8-tetramethyldecyl)carbamate.
| Compound Name | tert-butyl N-(10-amino-5,5,8,8-tetramethyldecyl)carbamate |
|---|---|
| PubChem CID | 169146336 |
| Molecular Formula | C19H40N2O2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | tert-butyl N-(10-amino-5,5,8,8-tetramethyldecyl)carbamate |
| SMILES | CC(C)(CCN)CCC(C)(C)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H40N2O2/c1-17(2,3)23-16(22)21-15-9-8-10-18(4,5)11-12-19(6,7)13-14-20/h8-15,20H2,1-7H3,(H,21,22) |
| InChIKey | TUEMLMLEYMXWGZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|