C20H45NO2 — CID 171066640
tert-butyl N-pentylcarbamate;bis(pentane) (PubChem CID 171066640) has the molecular formula C20H45NO2 and a molecular weight of 331.59 g/mol. Its IUPAC name is tert-butyl N-pentylcarbamate;bis(pentane).
| Compound Name | tert-butyl N-pentylcarbamate;bis(pentane) |
|---|---|
| PubChem CID | 171066640 |
| Molecular Formula | C20H45NO2 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.35 |
| IUPAC Name | tert-butyl N-pentylcarbamate;bis(pentane) |
| SMILES | CCCCC.CCCCC.CCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21NO2.2C5H12/c1-5-6-7-8-11-9(12)13-10(2,3)4;2*1-3-5-4-2/h5-8H2,1-4H3,(H,11,12);2*3-5H2,1-2H3 |
| InChIKey | XDCPWANTHHKAPM-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|