C17H33F3N2O3 — CID 160758432
tert-butyl N-[4-(hexylamino)butyl]carbamate;2,2,2-trifluoroacetaldehyde (PubChem CID 160758432) has the molecular formula C17H33F3N2O3 and a molecular weight of 370.46 g/mol. Its IUPAC name is tert-butyl N-[4-(hexylamino)butyl]carbamate;2,2,2-trifluoroacetaldehyde.
| Compound Name | tert-butyl N-[4-(hexylamino)butyl]carbamate;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 160758432 |
| Molecular Formula | C17H33F3N2O3 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | tert-butyl N-[4-(hexylamino)butyl]carbamate;2,2,2-trifluoroacetaldehyde |
| SMILES | CCCCCCNCCCCNC(=O)OC(C)(C)C.O=CC(F)(F)F |
| InChI | InChI=1S/C15H32N2O2.C2HF3O/c1-5-6-7-8-11-16-12-9-10-13-17-14(18)19-15(2,3)4;3-2(4,5)1-6/h16H,5-13H2,1-4H3,(H,17,18);1H |
| InChIKey | RXSUJOVDQDWWAO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|