C51H118N16O2 — CID 59987238
tert-butyl N-[6-[bis[2-[bis[3-[bis(3-aminopropyl)amino]propyl]amino]ethyl]amino]hexyl]carbamate (PubChem CID 59987238) has the molecular formula C51H118N16O2 and a molecular weight of 987.61 g/mol. Its IUPAC name is tert-butyl N-[6-[bis[2-[bis[3-[bis(3-aminopropyl)amino]propyl]amino]ethyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[bis[2-[bis[3-[bis(3-aminopropyl)amino]propyl]amino]ethyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 59987238 |
| Molecular Formula | C51H118N16O2 |
| Molecular Weight | 987.61 g/mol |
| Exact Mass | 986.96 |
| IUPAC Name | tert-butyl N-[6-[bis[2-[bis[3-[bis(3-aminopropyl)amino]propyl]amino]ethyl]amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCN(CCN(CCCN(CCCN)CCCN)CCCN(CCCN)CCCN)CCN(CCCN(CCCN)CCCN)CCCN(CCCN)CCCN |
| InChI | InChI=1S/C51H118N16O2/c1-51(2,3)69-50(68)60-28-6-4-5-7-29-67(48-46-65(42-16-38-61(30-8-20-52)31-9-21-53)43-17-39-62(32-10-22-54)33-11-23-55)49-47-66(44-18-40-63(34-12-24-56)35-13-25-57)45-19-41-64(36-14-26-58)37-15-27-59/h4-49,52-59H2,1-3H3,(H,60,68) |
| InChIKey | HSYHHMAKFIZCBQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 269.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.61 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|