C40H80N6O8 — CID 170606638
tert-butyl N-[4-[4-[bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]butyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]butyl]carbamate (PubChem CID 170606638) has the molecular formula C40H80N6O8 and a molecular weight of 773.11 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]butyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]butyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 170606638 |
| Molecular Formula | C40H80N6O8 |
| Molecular Weight | 773.11 g/mol |
| Exact Mass | 772.60 |
| IUPAC Name | tert-butyl N-[4-[4-[bis[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]butyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCN(CCCCNC(=O)OC(C)(C)C)CCCCN(CCCCNC(=O)OC(C)(C)C)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H80N6O8/c1-37(2,3)51-33(47)41-23-13-17-27-45(28-18-14-24-42-34(48)52-38(4,5)6)31-21-22-32-46(29-19-15-25-43-35(49)53-39(7,8)9)30-20-16-26-44-36(50)54-40(10,11)12/h13-32H2,1-12H3,(H,41,47)(H,42,48)(H,43,49)(H,44,50) |
| InChIKey | HDKVHFSXCNEJLG-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 159.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.11 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|