C17H35N3O3Zn — CID 164540767
zinc tert-butyl N-[3-[3-[di(ethyl)amino]propyl-(2-hydroxyethyl)amino]propyl]carbamate (PubChem CID 164540767) has the molecular formula C17H35N3O3Zn and a molecular weight of 394.88 g/mol. Its IUPAC name is zinc tert-butyl N-[3-[3-[di(ethyl)amino]propyl-(2-hydroxyethyl)amino]propyl]carbamate.
| Compound Name | zinc tert-butyl N-[3-[3-[di(ethyl)amino]propyl-(2-hydroxyethyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 164540767 |
| Molecular Formula | C17H35N3O3Zn |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | zinc tert-butyl N-[3-[3-[di(ethyl)amino]propyl-(2-hydroxyethyl)amino]propyl]carbamate |
| SMILES | [CH2-]CN(C[CH2-])CCCN(CCO)CCCNC(=O)OC(C)(C)C.[Zn+2] |
| InChI | InChI=1S/C17H35N3O3.Zn/c1-6-19(7-2)12-9-13-20(14-15-21)11-8-10-18-16(22)23-17(3,4)5;/h21H,1-2,6-15H2,3-5H3,(H,18,22);/q-2;+2 |
| InChIKey | HVIFETMHONJDEN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|