C21H40N4O4 — CID 10787851
tert-butyl N-[3-[3-cyanopropyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]propyl]carbamate (PubChem CID 10787851) has the molecular formula C21H40N4O4 and a molecular weight of 412.58 g/mol. Its IUPAC name is tert-butyl N-[3-[3-cyanopropyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-cyanopropyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 10787851 |
| Molecular Formula | C21H40N4O4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | tert-butyl N-[3-[3-cyanopropyl-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCN(CCCC#N)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H40N4O4/c1-20(2,3)28-18(26)23-13-8-10-16-25(15-9-7-12-22)17-11-14-24-19(27)29-21(4,5)6/h7-11,13-17H2,1-6H3,(H,23,26)(H,24,27) |
| InChIKey | CHYYVWABTDTZKY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|