C27H46N8O2 — CID 58892752
tert-butyl N-[6-[2-[bis(2-cyanoethyl)amino]ethyl-[2-[2-cyanoethyl(2-isocyanoethyl)amino]ethyl]amino]hexyl]carbamate (PubChem CID 58892752) has the molecular formula C27H46N8O2 and a molecular weight of 514.72 g/mol. Its IUPAC name is tert-butyl N-[6-[2-[bis(2-cyanoethyl)amino]ethyl-[2-[2-cyanoethyl(2-isocyanoethyl)amino]ethyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[2-[bis(2-cyanoethyl)amino]ethyl-[2-[2-cyanoethyl(2-isocyanoethyl)amino]ethyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 58892752 |
| Molecular Formula | C27H46N8O2 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | tert-butyl N-[6-[2-[bis(2-cyanoethyl)amino]ethyl-[2-[2-cyanoethyl(2-isocyanoethyl)amino]ethyl]amino]hexyl]carbamate |
| SMILES | [C-]#[N+]CCN(CCC#N)CCN(CCCCCCNC(=O)OC(C)(C)C)CCN(CCC#N)CCC#N |
| InChI | InChI=1S/C27H46N8O2/c1-27(2,3)37-26(36)32-15-7-5-6-8-17-35(24-22-33(18-9-12-28)19-10-13-29)25-23-34(20-11-14-30)21-16-31-4/h5-11,15-25H2,1-3H3,(H,32,36) |
| InChIKey | YKFHWAIEVRRIQA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|