C21H44N2O2 — CID 86645270
tert-butyl N-[2-(diheptylamino)ethyl]carbamate (PubChem CID 86645270) has the molecular formula C21H44N2O2 and a molecular weight of 356.60 g/mol. Its IUPAC name is tert-butyl N-[2-(diheptylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(diheptylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 86645270 |
| Molecular Formula | C21H44N2O2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | tert-butyl N-[2-(diheptylamino)ethyl]carbamate |
| SMILES | CCCCCCCN(CCCCCCC)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H44N2O2/c1-6-8-10-12-14-17-23(18-15-13-11-9-7-2)19-16-22-20(24)25-21(3,4)5/h6-19H2,1-5H3,(H,22,24) |
| InChIKey | JJTRETKABTXHHQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|