C54H102N2O10 — CID 175636573
[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate (PubChem CID 175636573) has the molecular formula C54H102N2O10 and a molecular weight of 939.41 g/mol. Its IUPAC name is [6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate.
| Compound Name | [6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate |
|---|---|
| PubChem CID | 175636573 |
| Molecular Formula | C54H102N2O10 |
| Molecular Weight | 939.41 g/mol |
| Exact Mass | 938.75 |
| IUPAC Name | [6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(CCCCN(CCCCC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)CCCNC(=O)OC(C)(C)C)COC(=O)CCCCCCC |
| InChI | InChI=1S/C54H102N2O10/c1-8-12-16-20-24-35-49(57)62-43-47(44-63-50(58)36-25-21-17-13-9-2)33-28-30-40-56(42-32-39-55-53(61)66-54(5,6)7)41-31-29-34-48(45-64-51(59)37-26-22-18-14-10-3)46-65-52(60)38-27-23-19-15-11-4/h47-48H,8-46H2,1-7H3,(H,55,61) |
| InChIKey | JYBPEAHRZKFRRU-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.41 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|