About 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate
2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate (PubChem CID 167600625) has the molecular formula C49H95NO5
and a molecular weight of 778.30 g/mol. Its IUPAC name is 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate.
Molecular Properties
| Compound Name | 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate |
| PubChem CID | 167600625 |
| Molecular Formula | C49H95NO5 |
| Molecular Weight | 778.30 g/mol |
| Exact Mass | 777.72 |
| IUPAC Name | 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate |
| SMILES | CCCCCCCC(=O)CCCCCN(CCCCCC(=O)OCC(CCCC)CCCCCC)CCCCCC(=O)OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C49H95NO5/c1-6-11-16-19-25-36-47(51)37-26-20-29-40-50(41-30-21-27-38-48(52)54-43-45(32-14-9-4)34-23-17-12-7-2)42-31-22-28-39-49(53)55-44-46(33-15-10-5)35-24-18-13-8-3/h45-46H,6-44H2,1-5H3 |
| InChIKey | JRJHMIWEUNRGEW-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 778.30 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate?
The IUPAC name of 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate (CID 167600625) is 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate.
What is the SMILES notation for 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate?
The canonical SMILES for 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate is CCCCCCCC(=O)CCCCCN(CCCCCC(=O)OCC(CCCC)CCCCCC)CCCCCC(=O)OCC(CCCC)CCCCCC.
What is the InChIKey of 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate?
The InChIKey is JRJHMIWEUNRGEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H95NO5/c1-6-11-16-19-25-36-47(51)37-26-20-29-40-50(41-30-21-27-38-48(52)54-43-45(32-14-9-4)34-23-17-12-7-2)42-31-22-28-39-49(53)55-44-46(33-15-10-5)35-24-18-13-8-3/h45-46H,6-44H2,1-5H3.
What are the key properties of 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate?
2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate has a molecular weight of 778.30 g/mol, XLogP of 14.54, 44 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyloctyl 6-[[6-(2-butyloctoxy)-6-oxohexyl]-(6-oxotridecyl)amino]hexanoate is sourced from PubChem (CID 167600625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).