C32H63NO5 — CID 177063054
ethyl 5-[[5-(2-hexyldecoxy)-5-oxopentyl]-(4-hydroxybutyl)amino]pentanoate (PubChem CID 177063054) has the molecular formula C32H63NO5 and a molecular weight of 541.86 g/mol. Its IUPAC name is ethyl 5-[[5-(2-hexyldecoxy)-5-oxopentyl]-(4-hydroxybutyl)amino]pentanoate.
| Compound Name | ethyl 5-[[5-(2-hexyldecoxy)-5-oxopentyl]-(4-hydroxybutyl)amino]pentanoate |
|---|---|
| PubChem CID | 177063054 |
| Molecular Formula | C32H63NO5 |
| Molecular Weight | 541.86 g/mol |
| Exact Mass | 541.47 |
| IUPAC Name | ethyl 5-[[5-(2-hexyldecoxy)-5-oxopentyl]-(4-hydroxybutyl)amino]pentanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCN(CCCCO)CCCCC(=O)OCC |
| InChI | InChI=1S/C32H63NO5/c1-4-7-9-11-12-14-22-30(21-13-10-8-5-2)29-38-32(36)24-16-18-26-33(27-19-20-28-34)25-17-15-23-31(35)37-6-3/h30,34H,4-29H2,1-3H3 |
| InChIKey | PPKIXDKYCIJCAG-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.86 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|