C52H103NO5 — CID 170079830
2-hexyldecyl 8-[[8-[(2S)-2-hexyldecoxy]-8-oxooctyl]-(4-hydroxybutyl)amino]octanoate (PubChem CID 170079830) has the molecular formula C52H103NO5 and a molecular weight of 822.40 g/mol. Its IUPAC name is 2-hexyldecyl 8-[[8-[(2S)-2-hexyldecoxy]-8-oxooctyl]-(4-hydroxybutyl)amino]octanoate.
| Compound Name | 2-hexyldecyl 8-[[8-[(2S)-2-hexyldecoxy]-8-oxooctyl]-(4-hydroxybutyl)amino]octanoate |
|---|---|
| PubChem CID | 170079830 |
| Molecular Formula | C52H103NO5 |
| Molecular Weight | 822.40 g/mol |
| Exact Mass | 821.78 |
| IUPAC Name | 2-hexyldecyl 8-[[8-[(2S)-2-hexyldecoxy]-8-oxooctyl]-(4-hydroxybutyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCCCN(CCCCO)CCCCCCCC(=O)OC[C@@H](CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C52H103NO5/c1-5-9-13-17-21-29-39-49(37-27-15-11-7-3)47-57-51(55)41-31-23-19-25-33-43-53(45-35-36-46-54)44-34-26-20-24-32-42-52(56)58-48-50(38-28-16-12-8-4)40-30-22-18-14-10-6-2/h49-50,54H,5-48H2,1-4H3/t49-,50?/m0/s1 |
| InChIKey | RUNMZEGRZDCEGU-OKFYPZDCSA-N |
| XLogP | 15.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.40 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|