C57H110N4O8 — CID 171548778
2-hexyloctyl 8-[3-[[3-[[8-(2-hexyloctoxy)-8-oxooctyl]amino]-3-oxopropyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propanoylamino]octanoate (PubChem CID 171548778) has the molecular formula C57H110N4O8 and a molecular weight of 979.53 g/mol. Its IUPAC name is 2-hexyloctyl 8-[3-[[3-[[8-(2-hexyloctoxy)-8-oxooctyl]amino]-3-oxopropyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propanoylamino]octanoate.
| Compound Name | 2-hexyloctyl 8-[3-[[3-[[8-(2-hexyloctoxy)-8-oxooctyl]amino]-3-oxopropyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propanoylamino]octanoate |
|---|---|
| PubChem CID | 171548778 |
| Molecular Formula | C57H110N4O8 |
| Molecular Weight | 979.53 g/mol |
| Exact Mass | 978.83 |
| IUPAC Name | 2-hexyloctyl 8-[3-[[3-[[8-(2-hexyloctoxy)-8-oxooctyl]amino]-3-oxopropyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propanoylamino]octanoate |
| SMILES | CCCCCCC(CCCCCC)COC(=O)CCCCCCCNC(=O)CCN(CCNC(=O)OC(C)(C)C)CCC(=O)NCCCCCCCC(=O)OCC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C57H110N4O8/c1-8-12-16-26-34-50(35-27-17-13-9-2)48-67-54(64)38-30-22-20-24-32-42-58-52(62)40-45-61(47-44-60-56(66)69-57(5,6)7)46-41-53(63)59-43-33-25-21-23-31-39-55(65)68-49-51(36-28-18-14-10-3)37-29-19-15-11-4/h50-51H,8-49H2,1-7H3,(H,58,62)(H,59,63)(H,60,66) |
| InChIKey | AHLLYBUFLUCRGF-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.53 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|