C54H108N2O6 — CID 168892013
4-pentylnonyl 8-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl-(11-pentylhexadecyl)amino]octanoate (PubChem CID 168892013) has the molecular formula C54H108N2O6 and a molecular weight of 881.47 g/mol. Its IUPAC name is 4-pentylnonyl 8-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl-(11-pentylhexadecyl)amino]octanoate.
| Compound Name | 4-pentylnonyl 8-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl-(11-pentylhexadecyl)amino]octanoate |
|---|---|
| PubChem CID | 168892013 |
| Molecular Formula | C54H108N2O6 |
| Molecular Weight | 881.47 g/mol |
| Exact Mass | 880.82 |
| IUPAC Name | 4-pentylnonyl 8-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl-(11-pentylhexadecyl)amino]octanoate |
| SMILES | CCCCCC(CCCCC)CCCCCCCCCCN(CCCCCCCC(=O)OCCCC(CCCCC)CCCCC)CCOCCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C54H108N2O6/c1-8-12-25-34-50(35-26-13-9-2)38-29-21-18-16-17-19-23-31-42-56(44-47-60-49-48-59-46-41-55-53(58)62-54(5,6)7)43-32-24-20-22-30-40-52(57)61-45-33-39-51(36-27-14-10-3)37-28-15-11-4/h50-51H,8-49H2,1-7H3,(H,55,58) |
| InChIKey | QZKVSBZYLYDZHV-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.47 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|