C82H158N4O10 — CID 174286558
8-[2-[[4-[2-[bis[8-oxo-8-(4-pentylnonoxy)octyl]amino]ethylamino]-4-oxobutanoyl]amino]ethyl-[8-oxo-8-(4-pentylnonoxy)octyl]amino]octanoic acid (PubChem CID 174286558) has the molecular formula C82H158N4O10 and a molecular weight of 1360.18 g/mol. Its IUPAC name is 8-[2-[[4-[2-[bis[8-oxo-8-(4-pentylnonoxy)octyl]amino]ethylamino]-4-oxobutanoyl]amino]ethyl-[8-oxo-8-(4-pentylnonoxy)octyl]amino]octanoic acid.
| Compound Name | 8-[2-[[4-[2-[bis[8-oxo-8-(4-pentylnonoxy)octyl]amino]ethylamino]-4-oxobutanoyl]amino]ethyl-[8-oxo-8-(4-pentylnonoxy)octyl]amino]octanoic acid |
|---|---|
| PubChem CID | 174286558 |
| Molecular Formula | C82H158N4O10 |
| Molecular Weight | 1360.18 g/mol |
| Exact Mass | 1359.20 |
| IUPAC Name | 8-[2-[[4-[2-[bis[8-oxo-8-(4-pentylnonoxy)octyl]amino]ethylamino]-4-oxobutanoyl]amino]ethyl-[8-oxo-8-(4-pentylnonoxy)octyl]amino]octanoic acid |
| SMILES | CCCCCC(CCCCC)CCCOC(=O)CCCCCCCN(CCCCCCCC(=O)O)CCNC(=O)CCC(=O)NCCN(CCCCCCCC(=O)OCCCC(CCCCC)CCCCC)CCCCCCCC(=O)OCCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C82H158N4O10/c1-7-13-31-48-74(49-32-14-8-2)54-45-71-94-80(91)58-38-24-20-28-42-66-85(65-41-27-19-23-37-57-79(89)90)69-63-83-77(87)61-62-78(88)84-64-70-86(67-43-29-21-25-39-59-81(92)95-72-46-55-75(50-33-15-9-3)51-34-16-10-4)68-44-30-22-26-40-60-82(93)96-73-47-56-76(52-35-17-11-5)53-36-18-12-6/h74-76H,7-73H2,1-6H3,(H,83,87)(H,84,88)(H,89,90) |
| InChIKey | UICRQUVKIXAOGE-UHFFFAOYSA-N |
| XLogP | 21.35 |
| TPSA | 180.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 77 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1360.18 |
| LogP ≤ 5 | 21.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|