C46H92N2O5 — CID 170756926
formic acid;nonyl 8-[2-acetamidoethyl(8-octylhexadecyl)amino]octanoate (PubChem CID 170756926) has the molecular formula C46H92N2O5 and a molecular weight of 753.25 g/mol. Its IUPAC name is formic acid;nonyl 8-[2-acetamidoethyl(8-octylhexadecyl)amino]octanoate.
| Compound Name | formic acid;nonyl 8-[2-acetamidoethyl(8-octylhexadecyl)amino]octanoate |
|---|---|
| PubChem CID | 170756926 |
| Molecular Formula | C46H92N2O5 |
| Molecular Weight | 753.25 g/mol |
| Exact Mass | 752.70 |
| IUPAC Name | formic acid;nonyl 8-[2-acetamidoethyl(8-octylhexadecyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(CCCCCCCC)CCCCCCCC)CCNC(C)=O.O=CO |
| InChI | InChI=1S/C45H90N2O3.CH2O2/c1-5-8-11-14-17-26-33-42-50-45(49)37-30-23-19-25-32-40-47(41-38-46-43(4)48)39-31-24-18-22-29-36-44(34-27-20-15-12-9-6-2)35-28-21-16-13-10-7-3;2-1-3/h44H,5-42H2,1-4H3,(H,46,48);1H,(H,2,3) |
| InChIKey | YQFFHBMVXVLFBK-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.25 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|