C42H85NO7 — CID 170754802
formic acid;nonyl 8-[[9-hexoxy-8-(hexoxymethyl)nonyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 170754802) has the molecular formula C42H85NO7 and a molecular weight of 716.14 g/mol. Its IUPAC name is formic acid;nonyl 8-[[9-hexoxy-8-(hexoxymethyl)nonyl]-(2-hydroxyethyl)amino]octanoate.
| Compound Name | formic acid;nonyl 8-[[9-hexoxy-8-(hexoxymethyl)nonyl]-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 170754802 |
| Molecular Formula | C42H85NO7 |
| Molecular Weight | 716.14 g/mol |
| Exact Mass | 715.63 |
| IUPAC Name | formic acid;nonyl 8-[[9-hexoxy-8-(hexoxymethyl)nonyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCCCCCCC(COCCCCCC)COCCCCCC.O=CO |
| InChI | InChI=1S/C41H83NO5.CH2O2/c1-4-7-10-13-14-21-28-37-47-41(44)30-23-18-16-20-25-32-42(33-34-43)31-24-19-15-17-22-29-40(38-45-35-26-11-8-5-2)39-46-36-27-12-9-6-3;2-1-3/h40,43H,4-39H2,1-3H3;1H,(H,2,3) |
| InChIKey | JDOLBRGIJDHXPM-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.14 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|