C49H93NO7 — CID 171770944
6-[2-hydroxyethyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]hexyl (Z)-octadec-9-enoate (PubChem CID 171770944) has the molecular formula C49H93NO7 and a molecular weight of 808.28 g/mol. Its IUPAC name is 6-[2-hydroxyethyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]hexyl (Z)-octadec-9-enoate.
| Compound Name | 6-[2-hydroxyethyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]hexyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 171770944 |
| Molecular Formula | C49H93NO7 |
| Molecular Weight | 808.28 g/mol |
| Exact Mass | 807.70 |
| IUPAC Name | 6-[2-hydroxyethyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]hexyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCCCN(CCO)CCCCC(COC(=O)CCCCCCC)COC(=O)CCCCCCC |
| InChI | InChI=1S/C49H93NO7/c1-4-7-10-13-14-15-16-17-18-19-20-21-22-25-30-36-47(52)55-43-34-27-26-32-39-50(41-42-51)40-33-31-35-46(44-56-48(53)37-28-23-11-8-5-2)45-57-49(54)38-29-24-12-9-6-3/h17-18,46,51H,4-16,19-45H2,1-3H3/b18-17- |
| InChIKey | VZDVARDUZIKRLH-ZCXUNETKSA-N |
| XLogP | 13.02 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.28 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|