C54H105NO5 — CID 167213359
2-octyldodecyl 6-[2-hydroxyethyl-[6-[2-[(E)-oct-6-enyl]dodecoxy]-6-oxohexyl]amino]hexanoate (PubChem CID 167213359) has the molecular formula C54H105NO5 and a molecular weight of 848.44 g/mol. Its IUPAC name is 2-octyldodecyl 6-[2-hydroxyethyl-[6-[2-[(E)-oct-6-enyl]dodecoxy]-6-oxohexyl]amino]hexanoate.
| Compound Name | 2-octyldodecyl 6-[2-hydroxyethyl-[6-[2-[(E)-oct-6-enyl]dodecoxy]-6-oxohexyl]amino]hexanoate |
|---|---|
| PubChem CID | 167213359 |
| Molecular Formula | C54H105NO5 |
| Molecular Weight | 848.44 g/mol |
| Exact Mass | 847.80 |
| IUPAC Name | 2-octyldodecyl 6-[2-hydroxyethyl-[6-[2-[(E)-oct-6-enyl]dodecoxy]-6-oxohexyl]amino]hexanoate |
| SMILES | C/C=C/CCCCCC(CCCCCCCCCC)COC(=O)CCCCCN(CCO)CCCCCC(=O)OCC(CCCCCCCC)CCCCCCCCCC |
| InChI | InChI=1S/C54H105NO5/c1-5-9-13-17-21-23-27-33-41-51(39-31-25-19-15-11-7-3)49-59-53(57)43-35-29-37-45-55(47-48-56)46-38-30-36-44-54(58)60-50-52(40-32-26-20-16-12-8-4)42-34-28-24-22-18-14-10-6-2/h7,11,51-52,56H,5-6,8-10,12-50H2,1-4H3/b11-7+ |
| InChIKey | KZKRMKDKQOQCDZ-YRNVUSSQSA-N |
| XLogP | 16.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.44 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|