C34H67NO4 — CID 176916994
2-hexyldecyl 8-[2-hydroxyethyl(8-oxooctyl)amino]octanoate (PubChem CID 176916994) has the molecular formula C34H67NO4 and a molecular weight of 553.91 g/mol. Its IUPAC name is 2-hexyldecyl 8-[2-hydroxyethyl(8-oxooctyl)amino]octanoate.
| Compound Name | 2-hexyldecyl 8-[2-hydroxyethyl(8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 176916994 |
| Molecular Formula | C34H67NO4 |
| Molecular Weight | 553.91 g/mol |
| Exact Mass | 553.51 |
| IUPAC Name | 2-hexyldecyl 8-[2-hydroxyethyl(8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCCCN(CCO)CCCCCCCC=O |
| InChI | InChI=1S/C34H67NO4/c1-3-5-7-9-13-19-25-33(24-18-8-6-4-2)32-39-34(38)26-20-14-12-16-22-28-35(29-31-37)27-21-15-10-11-17-23-30-36/h30,33,37H,3-29,31-32H2,1-2H3 |
| InChIKey | JWVJUWWNRSUARE-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.91 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|