C49H99NO4 — CID 171107837
ethane;2-hexyldecyl 6-[6-(2-hexyldecoxy)hept-6-enyl-(2-hydroxyethyl)amino]hexanoate (PubChem CID 171107837) has the molecular formula C49H99NO4 and a molecular weight of 766.33 g/mol. Its IUPAC name is ethane;2-hexyldecyl 6-[6-(2-hexyldecoxy)hept-6-enyl-(2-hydroxyethyl)amino]hexanoate.
| Compound Name | ethane;2-hexyldecyl 6-[6-(2-hexyldecoxy)hept-6-enyl-(2-hydroxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 171107837 |
| Molecular Formula | C49H99NO4 |
| Molecular Weight | 766.33 g/mol |
| Exact Mass | 765.76 |
| IUPAC Name | ethane;2-hexyldecyl 6-[6-(2-hexyldecoxy)hept-6-enyl-(2-hydroxyethyl)amino]hexanoate |
| SMILES | C=C(CCCCCN(CCO)CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)OCC(CCCCCC)CCCCCCCC.CC |
| InChI | InChI=1S/C47H93NO4.C2H6/c1-6-10-14-18-20-27-35-45(33-25-16-12-8-3)42-51-44(5)32-24-22-30-38-48(40-41-49)39-31-23-29-37-47(50)52-43-46(34-26-17-13-9-4)36-28-21-19-15-11-7-2;1-2/h45-46,49H,5-43H2,1-4H3;1-2H3 |
| InChIKey | OKQSAOBRVSORAA-UHFFFAOYSA-N |
| XLogP | 15.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.33 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|