C57H114N2O3 — CID 156805406
2-octyldodecyl 6-[2-(dimethylamino)ethyl-[6-(2-octyldodecoxy)hept-6-enyl]amino]hexanoate (PubChem CID 156805406) has the molecular formula C57H114N2O3 and a molecular weight of 875.55 g/mol. Its IUPAC name is 2-octyldodecyl 6-[2-(dimethylamino)ethyl-[6-(2-octyldodecoxy)hept-6-enyl]amino]hexanoate.
| Compound Name | 2-octyldodecyl 6-[2-(dimethylamino)ethyl-[6-(2-octyldodecoxy)hept-6-enyl]amino]hexanoate |
|---|---|
| PubChem CID | 156805406 |
| Molecular Formula | C57H114N2O3 |
| Molecular Weight | 875.55 g/mol |
| Exact Mass | 874.88 |
| IUPAC Name | 2-octyldodecyl 6-[2-(dimethylamino)ethyl-[6-(2-octyldodecoxy)hept-6-enyl]amino]hexanoate |
| SMILES | C=C(CCCCCN(CCCCCC(=O)OCC(CCCCCCCC)CCCCCCCCCC)CCN(C)C)OCC(CCCCCCCC)CCCCCCCCCC |
| InChI | InChI=1S/C57H114N2O3/c1-8-12-16-20-24-26-30-37-44-55(43-35-28-22-18-14-10-3)52-61-54(5)42-34-32-40-48-59(51-50-58(6)7)49-41-33-39-47-57(60)62-53-56(45-36-29-23-19-15-11-4)46-38-31-27-25-21-17-13-9-2/h55-56H,5,8-53H2,1-4,6-7H3 |
| InChIKey | FEFAWHGOGQTQAC-UHFFFAOYSA-N |
| XLogP | 17.84 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.55 |
| LogP ≤ 5 | 17.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|