C35H69NO4 — CID 177226760
3-pentyloctyl 9-[4-hydroxybutyl(9-oxononyl)amino]nonanoate (PubChem CID 177226760) has the molecular formula C35H69NO4 and a molecular weight of 567.94 g/mol. Its IUPAC name is 3-pentyloctyl 9-[4-hydroxybutyl(9-oxononyl)amino]nonanoate.
| Compound Name | 3-pentyloctyl 9-[4-hydroxybutyl(9-oxononyl)amino]nonanoate |
|---|---|
| PubChem CID | 177226760 |
| Molecular Formula | C35H69NO4 |
| Molecular Weight | 567.94 g/mol |
| Exact Mass | 567.52 |
| IUPAC Name | 3-pentyloctyl 9-[4-hydroxybutyl(9-oxononyl)amino]nonanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCCN(CCCCO)CCCCCCCCC=O |
| InChI | InChI=1S/C35H69NO4/c1-3-5-16-24-34(25-17-6-4-2)27-33-40-35(39)26-18-12-8-10-14-20-29-36(30-21-23-32-38)28-19-13-9-7-11-15-22-31-37/h31,34,38H,3-30,32-33H2,1-2H3 |
| InChIKey | CRXLDNIZQVMVRG-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.94 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|