C25H49NO4 — CID 171813855
nonyl 5-[3-hydroxypropyl(8-oxooctyl)amino]pentanoate (PubChem CID 171813855) has the molecular formula C25H49NO4 and a molecular weight of 427.67 g/mol. Its IUPAC name is nonyl 5-[3-hydroxypropyl(8-oxooctyl)amino]pentanoate.
| Compound Name | nonyl 5-[3-hydroxypropyl(8-oxooctyl)amino]pentanoate |
|---|---|
| PubChem CID | 171813855 |
| Molecular Formula | C25H49NO4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.37 |
| IUPAC Name | nonyl 5-[3-hydroxypropyl(8-oxooctyl)amino]pentanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCN(CCCO)CCCCCCCC=O |
| InChI | InChI=1S/C25H49NO4/c1-2-3-4-5-8-11-16-24-30-25(29)18-12-14-20-26(21-17-23-28)19-13-9-6-7-10-15-22-27/h22,28H,2-21,23-24H2,1H3 |
| InChIKey | KJHGIECDVQINNQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|