C29H57NO4 — CID 169229346
octyl 9-[4-hydroxybutyl(8-oxooctyl)amino]nonanoate (PubChem CID 169229346) has the molecular formula C29H57NO4 and a molecular weight of 483.78 g/mol. Its IUPAC name is octyl 9-[4-hydroxybutyl(8-oxooctyl)amino]nonanoate.
| Compound Name | octyl 9-[4-hydroxybutyl(8-oxooctyl)amino]nonanoate |
|---|---|
| PubChem CID | 169229346 |
| Molecular Formula | C29H57NO4 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 483.43 |
| IUPAC Name | octyl 9-[4-hydroxybutyl(8-oxooctyl)amino]nonanoate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCCN(CCCCO)CCCCCCCC=O |
| InChI | InChI=1S/C29H57NO4/c1-2-3-4-5-14-21-28-34-29(33)22-15-10-6-7-11-16-23-30(25-18-20-27-32)24-17-12-8-9-13-19-26-31/h26,32H,2-25,27-28H2,1H3 |
| InChIKey | QLOLKYRHTMLNNE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|