C22H43NO4 — CID 169189887
nonyl 5-[2-hydroxyethyl(6-oxohexyl)amino]pentanoate (PubChem CID 169189887) has the molecular formula C22H43NO4 and a molecular weight of 385.59 g/mol. Its IUPAC name is nonyl 5-[2-hydroxyethyl(6-oxohexyl)amino]pentanoate.
| Compound Name | nonyl 5-[2-hydroxyethyl(6-oxohexyl)amino]pentanoate |
|---|---|
| PubChem CID | 169189887 |
| Molecular Formula | C22H43NO4 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | nonyl 5-[2-hydroxyethyl(6-oxohexyl)amino]pentanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCN(CCO)CCCCCC=O |
| InChI | InChI=1S/C22H43NO4/c1-2-3-4-5-6-9-14-21-27-22(26)15-10-12-17-23(18-20-25)16-11-7-8-13-19-24/h19,25H,2-18,20-21H2,1H3 |
| InChIKey | VLCCQFJQPWOLMZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|