C54H107NO6 — CID 172580368
3-hexylundecyl 6-[[[7-(3-hexylundecoxy)-7-oxoheptyl]-(5-hydroxypentyl)amino]methyl]-7-hydroxyheptanoate (PubChem CID 172580368) has the molecular formula C54H107NO6 and a molecular weight of 866.45 g/mol. Its IUPAC name is 3-hexylundecyl 6-[[[7-(3-hexylundecoxy)-7-oxoheptyl]-(5-hydroxypentyl)amino]methyl]-7-hydroxyheptanoate.
| Compound Name | 3-hexylundecyl 6-[[[7-(3-hexylundecoxy)-7-oxoheptyl]-(5-hydroxypentyl)amino]methyl]-7-hydroxyheptanoate |
|---|---|
| PubChem CID | 172580368 |
| Molecular Formula | C54H107NO6 |
| Molecular Weight | 866.45 g/mol |
| Exact Mass | 865.81 |
| IUPAC Name | 3-hexylundecyl 6-[[[7-(3-hexylundecoxy)-7-oxoheptyl]-(5-hydroxypentyl)amino]methyl]-7-hydroxyheptanoate |
| SMILES | CCCCCCCCC(CCCCCC)CCOC(=O)CCCCCCN(CCCCCO)CC(CO)CCCCC(=O)OCCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C54H107NO6/c1-5-9-13-17-19-26-36-50(34-24-15-11-7-3)41-46-60-53(58)39-28-21-22-31-43-55(44-32-23-33-45-56)48-52(49-57)38-29-30-40-54(59)61-47-42-51(35-25-16-12-8-4)37-27-20-18-14-10-6-2/h50-52,56-57H,5-49H2,1-4H3 |
| InChIKey | MQSZXHILWKFJDV-UHFFFAOYSA-N |
| XLogP | 15.11 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.45 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|