C76H150N2O7S2 — CID 178033314
3-pentyloctyl 9-[4-[3-[bis[9-oxo-9-(3-pentyloctoxy)nonyl]amino]propyldisulfanyl]butyl-(3-hydroxypropyl)amino]nonanoate (PubChem CID 178033314) has the molecular formula C76H150N2O7S2 and a molecular weight of 1268.18 g/mol. Its IUPAC name is 3-pentyloctyl 9-[4-[3-[bis[9-oxo-9-(3-pentyloctoxy)nonyl]amino]propyldisulfanyl]butyl-(3-hydroxypropyl)amino]nonanoate.
| Compound Name | 3-pentyloctyl 9-[4-[3-[bis[9-oxo-9-(3-pentyloctoxy)nonyl]amino]propyldisulfanyl]butyl-(3-hydroxypropyl)amino]nonanoate |
|---|---|
| PubChem CID | 178033314 |
| Molecular Formula | C76H150N2O7S2 |
| Molecular Weight | 1268.18 g/mol |
| Exact Mass | 1267.09 |
| IUPAC Name | 3-pentyloctyl 9-[4-[3-[bis[9-oxo-9-(3-pentyloctoxy)nonyl]amino]propyldisulfanyl]butyl-(3-hydroxypropyl)amino]nonanoate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCCN(CCCO)CCCCSSCCCN(CCCCCCCCC(=O)OCCC(CCCCC)CCCCC)CCCCCCCCC(=O)OCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C76H150N2O7S2/c1-7-13-31-47-71(48-32-14-8-2)56-66-83-74(80)53-37-25-19-22-28-40-59-77(63-45-65-79)62-43-44-69-86-87-70-46-64-78(60-41-29-23-20-26-38-54-75(81)84-67-57-72(49-33-15-9-3)50-34-16-10-4)61-42-30-24-21-27-39-55-76(82)85-68-58-73(51-35-17-11-5)52-36-18-12-6/h71-73,79H,7-70H2,1-6H3 |
| InChIKey | OTFJGGOEHDZXAX-UHFFFAOYSA-N |
| XLogP | 22.85 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 73 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1268.18 |
| LogP ≤ 5 | 22.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|