C49H97NO6 — CID 171564266
3-pentyldecyl 6-hydroxy-7-[5-hydroxypentyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate (PubChem CID 171564266) has the molecular formula C49H97NO6 and a molecular weight of 796.32 g/mol. Its IUPAC name is 3-pentyldecyl 6-hydroxy-7-[5-hydroxypentyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate.
| Compound Name | 3-pentyldecyl 6-hydroxy-7-[5-hydroxypentyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate |
|---|---|
| PubChem CID | 171564266 |
| Molecular Formula | C49H97NO6 |
| Molecular Weight | 796.32 g/mol |
| Exact Mass | 795.73 |
| IUPAC Name | 3-pentyldecyl 6-hydroxy-7-[5-hydroxypentyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate |
| SMILES | CCCCCCCC(CCCCC)CCOC(=O)CCCCCCN(CCCCCO)CC(O)CCCCC(=O)OCCC(CCCCC)CCCCCCC |
| InChI | InChI=1S/C49H97NO6/c1-5-9-13-15-22-32-45(30-20-11-7-3)37-42-55-48(53)35-24-17-18-27-39-50(40-28-19-29-41-51)44-47(52)34-25-26-36-49(54)56-43-38-46(31-21-12-8-4)33-23-16-14-10-6-2/h45-47,51-52H,5-44H2,1-4H3 |
| InChIKey | MMRMIIKICILYGR-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.32 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|