C48H97NO6 — CID 171564291
4-butyldecyl formate;4-butyldecyl 7-[2-hydroxyheptyl(5-hydroxypentyl)amino]heptanoate (PubChem CID 171564291) has the molecular formula C48H97NO6 and a molecular weight of 784.30 g/mol. Its IUPAC name is 4-butyldecyl formate;4-butyldecyl 7-[2-hydroxyheptyl(5-hydroxypentyl)amino]heptanoate.
| Compound Name | 4-butyldecyl formate;4-butyldecyl 7-[2-hydroxyheptyl(5-hydroxypentyl)amino]heptanoate |
|---|---|
| PubChem CID | 171564291 |
| Molecular Formula | C48H97NO6 |
| Molecular Weight | 784.30 g/mol |
| Exact Mass | 783.73 |
| IUPAC Name | 4-butyldecyl formate;4-butyldecyl 7-[2-hydroxyheptyl(5-hydroxypentyl)amino]heptanoate |
| SMILES | CCCCCCC(CCCC)CCCOC(=O)CCCCCCN(CCCCCO)CC(O)CCCCC.CCCCCCC(CCCC)CCCOC=O |
| InChI | InChI=1S/C33H67NO4.C15H30O2/c1-4-7-10-15-22-31(21-9-6-3)23-20-29-38-33(37)25-16-11-12-17-26-34(27-18-13-19-28-35)30-32(36)24-14-8-5-2;1-3-5-7-8-11-15(10-6-4-2)12-9-13-17-14-16/h31-32,35-36H,4-30H2,1-3H3;14-15H,3-13H2,1-2H3 |
| InChIKey | ZOBKLHXRFDQWIE-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.30 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|