C48H95NO6 — CID 171564287
3-pentyldecyl 7-[[7-(7-ethyl-2-methylundecan-4-yl)oxy-7-oxoheptyl]-(5-hydroxypentyl)amino]-6-hydroxyheptanoate (PubChem CID 171564287) has the molecular formula C48H95NO6 and a molecular weight of 782.29 g/mol. Its IUPAC name is 3-pentyldecyl 7-[[7-(7-ethyl-2-methylundecan-4-yl)oxy-7-oxoheptyl]-(5-hydroxypentyl)amino]-6-hydroxyheptanoate.
| Compound Name | 3-pentyldecyl 7-[[7-(7-ethyl-2-methylundecan-4-yl)oxy-7-oxoheptyl]-(5-hydroxypentyl)amino]-6-hydroxyheptanoate |
|---|---|
| PubChem CID | 171564287 |
| Molecular Formula | C48H95NO6 |
| Molecular Weight | 782.29 g/mol |
| Exact Mass | 781.72 |
| IUPAC Name | 3-pentyldecyl 7-[[7-(7-ethyl-2-methylundecan-4-yl)oxy-7-oxoheptyl]-(5-hydroxypentyl)amino]-6-hydroxyheptanoate |
| SMILES | CCCCCCCC(CCCCC)CCOC(=O)CCCCC(O)CN(CCCCCO)CCCCCCC(=O)OC(CCC(CC)CCCC)CC(C)C |
| InChI | InChI=1S/C48H95NO6/c1-7-11-14-15-20-29-44(28-19-12-8-2)35-39-54-47(52)31-23-22-30-45(51)41-49(37-25-18-26-38-50)36-24-17-16-21-32-48(53)55-46(40-42(5)6)34-33-43(10-4)27-13-9-3/h42-46,50-51H,7-41H2,1-6H3 |
| InChIKey | AOPKOGANUOVMGH-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.29 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|