C42H83NO6 — CID 171564472
nonyl 8-[[8-(7-ethyl-2-methylundecan-4-yl)oxy-8-oxooctyl]-(3-hydroxypropyl)amino]-7-hydroxyoctanoate (PubChem CID 171564472) has the molecular formula C42H83NO6 and a molecular weight of 698.13 g/mol. Its IUPAC name is nonyl 8-[[8-(7-ethyl-2-methylundecan-4-yl)oxy-8-oxooctyl]-(3-hydroxypropyl)amino]-7-hydroxyoctanoate.
| Compound Name | nonyl 8-[[8-(7-ethyl-2-methylundecan-4-yl)oxy-8-oxooctyl]-(3-hydroxypropyl)amino]-7-hydroxyoctanoate |
|---|---|
| PubChem CID | 171564472 |
| Molecular Formula | C42H83NO6 |
| Molecular Weight | 698.13 g/mol |
| Exact Mass | 697.62 |
| IUPAC Name | nonyl 8-[[8-(7-ethyl-2-methylundecan-4-yl)oxy-8-oxooctyl]-(3-hydroxypropyl)amino]-7-hydroxyoctanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCC(O)CN(CCCO)CCCCCCCC(=O)OC(CCC(CC)CCCC)CC(C)C |
| InChI | InChI=1S/C42H83NO6/c1-6-9-11-12-13-17-23-34-48-41(46)27-21-18-19-26-39(45)36-43(32-24-33-44)31-22-16-14-15-20-28-42(47)49-40(35-37(4)5)30-29-38(8-3)25-10-7-2/h37-40,44-45H,6-36H2,1-5H3 |
| InChIKey | BEDARXCRTXLTEN-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.13 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|