C41H81NO7 — CID 176869604
pentyl 8-[(8-heptadecan-9-yloxy-2-hydroxy-8-oxooctyl)-(3-hydroxypropyl)amino]-7-hydroxyoctanoate (PubChem CID 176869604) has the molecular formula C41H81NO7 and a molecular weight of 700.10 g/mol. Its IUPAC name is pentyl 8-[(8-heptadecan-9-yloxy-2-hydroxy-8-oxooctyl)-(3-hydroxypropyl)amino]-7-hydroxyoctanoate.
| Compound Name | pentyl 8-[(8-heptadecan-9-yloxy-2-hydroxy-8-oxooctyl)-(3-hydroxypropyl)amino]-7-hydroxyoctanoate |
|---|---|
| PubChem CID | 176869604 |
| Molecular Formula | C41H81NO7 |
| Molecular Weight | 700.10 g/mol |
| Exact Mass | 699.60 |
| IUPAC Name | pentyl 8-[(8-heptadecan-9-yloxy-2-hydroxy-8-oxooctyl)-(3-hydroxypropyl)amino]-7-hydroxyoctanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCC(O)CN(CCCO)CC(O)CCCCCC(=O)OCCCCC |
| InChI | InChI=1S/C41H81NO7/c1-4-7-10-12-14-20-28-39(29-21-15-13-11-8-5-2)49-41(47)31-23-17-19-27-38(45)36-42(32-25-33-43)35-37(44)26-18-16-22-30-40(46)48-34-24-9-6-3/h37-39,43-45H,4-36H2,1-3H3 |
| InChIKey | FYRLEDZYSAWQBO-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.10 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|