C45H89NO6 — CID 171428746
nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(3-hydroxypropyl)amino]-7-hydroxyoctanoate (PubChem CID 171428746) has the molecular formula C45H89NO6 and a molecular weight of 740.21 g/mol. Its IUPAC name is nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(3-hydroxypropyl)amino]-7-hydroxyoctanoate.
| Compound Name | nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(3-hydroxypropyl)amino]-7-hydroxyoctanoate |
|---|---|
| PubChem CID | 171428746 |
| Molecular Formula | C45H89NO6 |
| Molecular Weight | 740.21 g/mol |
| Exact Mass | 739.67 |
| IUPAC Name | nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(3-hydroxypropyl)amino]-7-hydroxyoctanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCC(O)CN(CCCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C45H89NO6/c1-4-7-10-13-16-22-30-40-51-44(49)35-28-23-24-32-42(48)41-46(38-31-39-47)37-29-21-17-20-27-36-45(50)52-43(33-25-18-14-11-8-5-2)34-26-19-15-12-9-6-3/h42-43,47-48H,4-41H2,1-3H3 |
| InChIKey | QTPSJRXLWYNZJV-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.21 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|