C41H81NO6S — CID 171808141
heptadecan-9-yl 8-[(6-heptoxy-6-oxohexyl)-(3-hydroxypropyl)amino]-7-hydroxysulfanyloctanoate (PubChem CID 171808141) has the molecular formula C41H81NO6S and a molecular weight of 716.17 g/mol. Its IUPAC name is heptadecan-9-yl 8-[(6-heptoxy-6-oxohexyl)-(3-hydroxypropyl)amino]-7-hydroxysulfanyloctanoate.
| Compound Name | heptadecan-9-yl 8-[(6-heptoxy-6-oxohexyl)-(3-hydroxypropyl)amino]-7-hydroxysulfanyloctanoate |
|---|---|
| PubChem CID | 171808141 |
| Molecular Formula | C41H81NO6S |
| Molecular Weight | 716.17 g/mol |
| Exact Mass | 715.58 |
| IUPAC Name | heptadecan-9-yl 8-[(6-heptoxy-6-oxohexyl)-(3-hydroxypropyl)amino]-7-hydroxysulfanyloctanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCC(CN(CCCO)CCCCCC(=O)OCCCCCCC)SO |
| InChI | InChI=1S/C41H81NO6S/c1-4-7-10-13-15-20-28-38(29-21-16-14-11-8-5-2)48-41(45)32-23-18-22-30-39(49-46)37-42(34-27-35-43)33-25-19-24-31-40(44)47-36-26-17-12-9-6-3/h38-39,43,46H,4-37H2,1-3H3 |
| InChIKey | XLNKBISXLCPQMY-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.17 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|