C41H81NO6 — CID 176869639
heptadecan-9-yl 7-hydroxy-8-[3-hydroxypropyl-[3-(8-methylnonoxy)-3-oxopropyl]amino]octanoate (PubChem CID 176869639) has the molecular formula C41H81NO6 and a molecular weight of 684.10 g/mol. Its IUPAC name is heptadecan-9-yl 7-hydroxy-8-[3-hydroxypropyl-[3-(8-methylnonoxy)-3-oxopropyl]amino]octanoate.
| Compound Name | heptadecan-9-yl 7-hydroxy-8-[3-hydroxypropyl-[3-(8-methylnonoxy)-3-oxopropyl]amino]octanoate |
|---|---|
| PubChem CID | 176869639 |
| Molecular Formula | C41H81NO6 |
| Molecular Weight | 684.10 g/mol |
| Exact Mass | 683.61 |
| IUPAC Name | heptadecan-9-yl 7-hydroxy-8-[3-hydroxypropyl-[3-(8-methylnonoxy)-3-oxopropyl]amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCC(O)CN(CCCO)CCC(=O)OCCCCCCCC(C)C |
| InChI | InChI=1S/C41H81NO6/c1-5-7-9-11-15-21-28-39(29-22-16-12-10-8-6-2)48-41(46)30-23-18-20-27-38(44)36-42(32-25-34-43)33-31-40(45)47-35-24-17-13-14-19-26-37(3)4/h37-39,43-44H,5-36H2,1-4H3 |
| InChIKey | NPALTSMGMYPBGH-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.10 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|