C51H101NO5 — CID 171564243
5-(4-methoxybutan-2-yl)undecane;3-pentyldecyl 6-hydroxy-7-[5-hydroxypentyl(oct-7-ynyl)amino]heptanoate (PubChem CID 171564243) has the molecular formula C51H101NO5 and a molecular weight of 808.37 g/mol. Its IUPAC name is 5-(4-methoxybutan-2-yl)undecane;3-pentyldecyl 6-hydroxy-7-[5-hydroxypentyl(oct-7-ynyl)amino]heptanoate.
| Compound Name | 5-(4-methoxybutan-2-yl)undecane;3-pentyldecyl 6-hydroxy-7-[5-hydroxypentyl(oct-7-ynyl)amino]heptanoate |
|---|---|
| PubChem CID | 171564243 |
| Molecular Formula | C51H101NO5 |
| Molecular Weight | 808.37 g/mol |
| Exact Mass | 807.77 |
| IUPAC Name | 5-(4-methoxybutan-2-yl)undecane;3-pentyldecyl 6-hydroxy-7-[5-hydroxypentyl(oct-7-ynyl)amino]heptanoate |
| SMILES | C#CCCCCCCN(CCCCCO)CC(O)CCCCC(=O)OCCC(CCCCC)CCCCCCC.CCCCCCC(CCCC)C(C)CCOC |
| InChI | InChI=1S/C35H67NO4.C16H34O/c1-4-7-10-12-14-20-28-36(29-21-15-22-30-37)32-34(38)25-18-19-26-35(39)40-31-27-33(23-16-9-6-3)24-17-13-11-8-5-2;1-5-7-9-10-12-16(11-8-6-2)15(3)13-14-17-4/h1,33-34,37-38H,5-32H2,2-3H3;15-16H,5-14H2,1-4H3 |
| InChIKey | RRWFGEIDWDRTIB-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.37 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|