C41H80NO5W- — CID 171073983
dec-2-ynyl 6-[4-hydroxybutyl(2-hydroxyhexyl)amino]hexanoate;pentadecan-7-ol;tungsten (PubChem CID 171073983) has the molecular formula C41H80NO5W- and a molecular weight of 850.93 g/mol. Its IUPAC name is dec-2-ynyl 6-[4-hydroxybutyl(2-hydroxyhexyl)amino]hexanoate;pentadecan-7-ol;tungsten.
| Compound Name | dec-2-ynyl 6-[4-hydroxybutyl(2-hydroxyhexyl)amino]hexanoate;pentadecan-7-ol;tungsten |
|---|---|
| PubChem CID | 171073983 |
| Molecular Formula | C41H80NO5W- |
| Molecular Weight | 850.93 g/mol |
| Exact Mass | 850.56 |
| IUPAC Name | dec-2-ynyl 6-[4-hydroxybutyl(2-hydroxyhexyl)amino]hexanoate;pentadecan-7-ol;tungsten |
| SMILES | CCCCCCCCC(O)CCCCCC.[CH2-]CCCC(O)CN(CCCCO)CCCCCC(=O)OCC#CCCCCCCC.[W] |
| InChI | InChI=1S/C26H48NO4.C15H32O.W/c1-3-5-7-8-9-10-11-17-23-31-26(30)19-13-12-14-20-27(21-15-16-22-28)24-25(29)18-6-4-2;1-3-5-7-9-10-12-14-15(16)13-11-8-6-4-2;/h25,28-29H,2-10,12-16,18-24H2,1H3;15-16H,3-14H2,1-2H3;/q-1;; |
| InChIKey | RDNAYQJOYLEKHO-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.93 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|