C39H77NO7 — CID 171428804
[(6S)-7-[(3-butyl-2-hydroxyheptyl)-(4-hydroxybutyl)amino]-6-hydroxy-2-(octanoyloxymethyl)heptyl] octanoate (PubChem CID 171428804) has the molecular formula C39H77NO7 and a molecular weight of 672.04 g/mol. Its IUPAC name is [(6S)-7-[(3-butyl-2-hydroxyheptyl)-(4-hydroxybutyl)amino]-6-hydroxy-2-(octanoyloxymethyl)heptyl] octanoate.
| Compound Name | [(6S)-7-[(3-butyl-2-hydroxyheptyl)-(4-hydroxybutyl)amino]-6-hydroxy-2-(octanoyloxymethyl)heptyl] octanoate |
|---|---|
| PubChem CID | 171428804 |
| Molecular Formula | C39H77NO7 |
| Molecular Weight | 672.04 g/mol |
| Exact Mass | 671.57 |
| IUPAC Name | [(6S)-7-[(3-butyl-2-hydroxyheptyl)-(4-hydroxybutyl)amino]-6-hydroxy-2-(octanoyloxymethyl)heptyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(CCC[C@H](O)CN(CCCCO)CC(O)C(CCCC)CCCC)COC(=O)CCCCCCC |
| InChI | InChI=1S/C39H77NO7/c1-5-9-13-15-17-26-38(44)46-32-34(33-47-39(45)27-18-16-14-10-6-2)22-21-25-36(42)30-40(28-19-20-29-41)31-37(43)35(23-11-7-3)24-12-8-4/h34-37,41-43H,5-33H2,1-4H3/t36-,37?/m0/s1 |
| InChIKey | YVSRXELADZTFSH-NWDJCJOJSA-N |
| XLogP | 8.37 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.04 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|