C29H59NO3 — CID 171074049
2-hexyldecyl 6-[2-hydroxybutyl(propyl)amino]hexanoate (PubChem CID 171074049) has the molecular formula C29H59NO3 and a molecular weight of 469.80 g/mol. Its IUPAC name is 2-hexyldecyl 6-[2-hydroxybutyl(propyl)amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[2-hydroxybutyl(propyl)amino]hexanoate |
|---|---|
| PubChem CID | 171074049 |
| Molecular Formula | C29H59NO3 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.45 |
| IUPAC Name | 2-hexyldecyl 6-[2-hydroxybutyl(propyl)amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCC)CC(O)CC |
| InChI | InChI=1S/C29H59NO3/c1-5-9-11-13-14-17-21-27(20-16-12-10-6-2)26-33-29(32)22-18-15-19-24-30(23-7-3)25-28(31)8-4/h27-28,31H,5-26H2,1-4H3 |
| InChIKey | WQSZVAOTSOXZRW-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|