C42H79NO6S — CID 174325288
2-hexyldecyl 6-[[3-(3-dec-2-ynoxy-3-oxopropyl)sulfanyl-2-hydroxypropyl]-(4-hydroxybutyl)amino]hexanoate (PubChem CID 174325288) has the molecular formula C42H79NO6S and a molecular weight of 726.16 g/mol. Its IUPAC name is 2-hexyldecyl 6-[[3-(3-dec-2-ynoxy-3-oxopropyl)sulfanyl-2-hydroxypropyl]-(4-hydroxybutyl)amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[[3-(3-dec-2-ynoxy-3-oxopropyl)sulfanyl-2-hydroxypropyl]-(4-hydroxybutyl)amino]hexanoate |
|---|---|
| PubChem CID | 174325288 |
| Molecular Formula | C42H79NO6S |
| Molecular Weight | 726.16 g/mol |
| Exact Mass | 725.56 |
| IUPAC Name | 2-hexyldecyl 6-[[3-(3-dec-2-ynoxy-3-oxopropyl)sulfanyl-2-hydroxypropyl]-(4-hydroxybutyl)amino]hexanoate |
| SMILES | CCCCCCCC#CCOC(=O)CCSCC(O)CN(CCCCO)CCCCCC(=O)OCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C42H79NO6S/c1-4-7-10-13-15-16-18-26-34-48-42(47)30-35-50-38-40(45)36-43(32-24-25-33-44)31-23-19-22-29-41(46)49-37-39(27-20-12-9-6-3)28-21-17-14-11-8-5-2/h39-40,44-45H,4-17,19-25,27-38H2,1-3H3 |
| InChIKey | KNRBWXVAZFMYEA-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.16 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|