C48H95NO6S — CID 171073868
3-[3-[[6-(2-hexyldecoxy)-6-oxohexyl]-(4-hydroxybutyl)amino]-2-hydroxypropyl]sulfanylpropyl 2-hexyldecanoate (PubChem CID 171073868) has the molecular formula C48H95NO6S and a molecular weight of 814.36 g/mol. Its IUPAC name is 3-[3-[[6-(2-hexyldecoxy)-6-oxohexyl]-(4-hydroxybutyl)amino]-2-hydroxypropyl]sulfanylpropyl 2-hexyldecanoate.
| Compound Name | 3-[3-[[6-(2-hexyldecoxy)-6-oxohexyl]-(4-hydroxybutyl)amino]-2-hydroxypropyl]sulfanylpropyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 171073868 |
| Molecular Formula | C48H95NO6S |
| Molecular Weight | 814.36 g/mol |
| Exact Mass | 813.69 |
| IUPAC Name | 3-[3-[[6-(2-hexyldecoxy)-6-oxohexyl]-(4-hydroxybutyl)amino]-2-hydroxypropyl]sulfanylpropyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCCCO)CC(O)CSCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C48H95NO6S/c1-5-9-13-17-19-23-32-44(31-22-15-11-7-3)42-55-47(52)35-26-21-27-36-49(37-28-29-38-50)41-46(51)43-56-40-30-39-54-48(53)45(33-24-16-12-8-4)34-25-20-18-14-10-6-2/h44-46,50-51H,5-43H2,1-4H3 |
| InChIKey | BOACKHCHCFTVOH-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.36 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|