C48H95ClN2O5 — CID 171074052
2-[[3-[5-chloropentyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]-2-hydroxypropyl]amino]ethyl 2-hexyldecanoate (PubChem CID 171074052) has the molecular formula C48H95ClN2O5 and a molecular weight of 815.75 g/mol. Its IUPAC name is 2-[[3-[5-chloropentyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]-2-hydroxypropyl]amino]ethyl 2-hexyldecanoate.
| Compound Name | 2-[[3-[5-chloropentyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]-2-hydroxypropyl]amino]ethyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 171074052 |
| Molecular Formula | C48H95ClN2O5 |
| Molecular Weight | 815.75 g/mol |
| Exact Mass | 814.69 |
| IUPAC Name | 2-[[3-[5-chloropentyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]-2-hydroxypropyl]amino]ethyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCCCCCl)CC(O)CNCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C48H95ClN2O5/c1-5-9-13-17-19-24-32-44(31-23-15-11-7-3)43-56-47(53)35-27-21-29-38-51(39-30-22-28-36-49)42-46(52)41-50-37-40-55-48(54)45(33-25-16-12-8-4)34-26-20-18-14-10-6-2/h44-46,50,52H,5-43H2,1-4H3 |
| InChIKey | FXJFHNLKCDISKK-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.75 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|