C52H104N2O5 — CID 171074018
2-hexyldecyl 6-[2-hydroxybutyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]hexanoate;propyl 2-hexyldecanoate (PubChem CID 171074018) has the molecular formula C52H104N2O5 and a molecular weight of 837.41 g/mol. Its IUPAC name is 2-hexyldecyl 6-[2-hydroxybutyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]hexanoate;propyl 2-hexyldecanoate.
| Compound Name | 2-hexyldecyl 6-[2-hydroxybutyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]hexanoate;propyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 171074018 |
| Molecular Formula | C52H104N2O5 |
| Molecular Weight | 837.41 g/mol |
| Exact Mass | 836.79 |
| IUPAC Name | 2-hexyldecyl 6-[2-hydroxybutyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]hexanoate;propyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCC.CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCC1CCCN1C)CC(O)CC |
| InChI | InChI=1S/C33H66N2O3.C19H38O2/c1-5-8-10-12-13-16-21-30(20-15-11-9-6-2)29-38-33(37)23-17-14-18-26-35(28-32(36)7-3)27-24-31-22-19-25-34(31)4;1-4-7-9-11-12-14-16-18(15-13-10-8-5-2)19(20)21-17-6-3/h30-32,36H,5-29H2,1-4H3;18H,4-17H2,1-3H3 |
| InChIKey | FIDTUZJCVWUEHJ-UHFFFAOYSA-N |
| XLogP | 14.26 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.41 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|