C41H79N3O4 — CID 170609400
6-[2-[cyclobutyl-[(1-methylpiperidin-2-yl)methyl]amino]ethyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoic acid (PubChem CID 170609400) has the molecular formula C41H79N3O4 and a molecular weight of 678.10 g/mol. Its IUPAC name is 6-[2-[cyclobutyl-[(1-methylpiperidin-2-yl)methyl]amino]ethyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoic acid.
| Compound Name | 6-[2-[cyclobutyl-[(1-methylpiperidin-2-yl)methyl]amino]ethyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 170609400 |
| Molecular Formula | C41H79N3O4 |
| Molecular Weight | 678.10 g/mol |
| Exact Mass | 677.61 |
| IUPAC Name | 6-[2-[cyclobutyl-[(1-methylpiperidin-2-yl)methyl]amino]ethyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoic acid |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCCCCC(=O)O)CCN(CC1CCCCN1C)C1CCC1 |
| InChI | InChI=1S/C41H79N3O4/c1-4-6-8-10-11-15-24-37(23-14-9-7-5-2)36-48-41(47)29-17-13-20-32-43(31-19-12-16-28-40(45)46)33-34-44(38-26-22-27-38)35-39-25-18-21-30-42(39)3/h37-39H,4-36H2,1-3H3,(H,45,46) |
| InChIKey | FWIPMNHOHLKDOF-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.10 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|